C12H22O4Si — CID 77251164
3-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-6-one (PubChem CID 77251164) has the molecular formula C12H22O4Si and a molecular weight of 258.39 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-6-one.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-6-one |
|---|---|
| PubChem CID | 77251164 |
| Molecular Formula | C12H22O4Si |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-6-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1COC2C(=O)COC12 |
| InChI | InChI=1S/C12H22O4Si/c1-12(2,3)17(4,5)16-9-7-15-10-8(13)6-14-11(9)10/h9-11H,6-7H2,1-5H3 |
| InChIKey | JHFRMLHQIRCWEB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|