C26H38O4 — CID 77255554
10,13-dimethyl-17-[2-(oxan-2-yloxy)acetyl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 77255554) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is 10,13-dimethyl-17-[2-(oxan-2-yloxy)acetyl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 10,13-dimethyl-17-[2-(oxan-2-yloxy)acetyl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 77255554 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 10,13-dimethyl-17-[2-(oxan-2-yloxy)acetyl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC12CCC(=O)C=C1CCC1C2CCC2(C)C(C(=O)COC3CCCCO3)CCC12 |
| InChI | InChI=1S/C26H38O4/c1-25-12-10-18(27)15-17(25)6-7-19-20-8-9-22(26(20,2)13-11-21(19)25)23(28)16-30-24-5-3-4-14-29-24/h15,19-22,24H,3-14,16H2,1-2H3 |
| InChIKey | HJBFKCBQEVRXLS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |