About methyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylate
methyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 772558) has the molecular formula C20H15N3O2
and a molecular weight of 329.36 g/mol. Its IUPAC name is methyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylate |
| PubChem CID | 772558 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | methyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1cc2nc(-c3ccccc3)cc(-c3ccccc3)n2n1 |
| InChI | InChI=1S/C20H15N3O2/c1-25-20(24)17-13-19-21-16(14-8-4-2-5-9-14)12-18(23(19)22-17)15-10-6-3-7-11-15/h2-13H,1H3 |
| InChIKey | MVBSJTBKFFPJBX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylate?
The IUPAC name of methyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylate (CID 772558) is methyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylate.
What is the SMILES notation for methyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylate?
The canonical SMILES for methyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylate is COC(=O)c1cc2nc(-c3ccccc3)cc(-c3ccccc3)n2n1.
What is the InChIKey of methyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylate?
The InChIKey is MVBSJTBKFFPJBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O2/c1-25-20(24)17-13-19-21-16(14-8-4-2-5-9-14)12-18(23(19)22-17)15-10-6-3-7-11-15/h2-13H,1H3.
What are the key properties of methyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylate?
methyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylate has a molecular weight of 329.36 g/mol, XLogP of 3.85, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylate is sourced from PubChem (CID 772558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).