About [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,6-difluorobenzoate
[(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,6-difluorobenzoate (PubChem CID 7725663) has the molecular formula C19H17F2NO3
and a molecular weight of 345.35 g/mol. Its IUPAC name is [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,6-difluorobenzoate.
Molecular Properties
| Compound Name | [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,6-difluorobenzoate |
| PubChem CID | 7725663 |
| Molecular Formula | C19H17F2NO3 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,6-difluorobenzoate |
| SMILES | C[C@H](OC(=O)c1c(F)cccc1F)C(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H17F2NO3/c1-12(25-19(24)17-15(20)7-4-8-16(17)21)18(23)22-10-9-13-5-2-3-6-14(13)11-22/h2-8,12H,9-11H2,1H3/t12-/m0/s1 |
| InChIKey | GCNFASQLASKMFS-LBPRGKRZSA-N |
| XLogP | 3.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,6-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,6-difluorobenzoate?
The IUPAC name of [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,6-difluorobenzoate (CID 7725663) is [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,6-difluorobenzoate.
What is the SMILES notation for [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,6-difluorobenzoate?
The canonical SMILES for [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,6-difluorobenzoate is C[C@H](OC(=O)c1c(F)cccc1F)C(=O)N1CCc2ccccc2C1.
What is the InChIKey of [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,6-difluorobenzoate?
The InChIKey is GCNFASQLASKMFS-LBPRGKRZSA-N. The full InChI is InChI=1S/C19H17F2NO3/c1-12(25-19(24)17-15(20)7-4-8-16(17)21)18(23)22-10-9-13-5-2-3-6-14(13)11-22/h2-8,12H,9-11H2,1H3/t12-/m0/s1.
What are the key properties of [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,6-difluorobenzoate?
[(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,6-difluorobenzoate has a molecular weight of 345.35 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2,6-difluorobenzoate is sourced from PubChem (CID 7725663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).