C25H21F3NO5S- — CID 77258694
5-(carboxymethoxy)-1-[N-sulfinato-4-[3-(trifluoromethyl)phenyl]anilino]-1,2,3,4-tetrahydronaphthalene (PubChem CID 77258694) has the molecular formula C25H21F3NO5S- and a molecular weight of 504.51 g/mol. Its IUPAC name is 5-(carboxymethoxy)-1-[N-sulfinato-4-[3-(trifluoromethyl)phenyl]anilino]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-(carboxymethoxy)-1-[N-sulfinato-4-[3-(trifluoromethyl)phenyl]anilino]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 77258694 |
| Molecular Formula | C25H21F3NO5S- |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 5-(carboxymethoxy)-1-[N-sulfinato-4-[3-(trifluoromethyl)phenyl]anilino]-1,2,3,4-tetrahydronaphthalene |
| SMILES | O=C(O)COc1cccc2c1CCCC2N(c1ccc(-c2cccc(C(F)(F)F)c2)cc1)S(=O)[O-] |
| InChI | InChI=1S/C25H22F3NO5S/c26-25(27,28)18-5-1-4-17(14-18)16-10-12-19(13-11-16)29(35(32)33)22-8-2-7-21-20(22)6-3-9-23(21)34-15-24(30)31/h1,3-6,9-14,22H,2,7-8,15H2,(H,30,31)(H,32,33)/p-1 |
| InChIKey | IPHXITLCZSNOBA-UHFFFAOYSA-M |
| XLogP | 5.51 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|