About [2-(2,6-dimethylmorpholin-4-yl)-6-fluoro-5-(2-pyrazin-2-ylethynyl)-3-pyridinyl]methanol
[2-(2,6-dimethylmorpholin-4-yl)-6-fluoro-5-(2-pyrazin-2-ylethynyl)-3-pyridinyl]methanol (PubChem CID 77265974) has the molecular formula C18H19FN4O2
and a molecular weight of 342.37 g/mol. Its IUPAC name is [2-(2,6-dimethylmorpholin-4-yl)-6-fluoro-5-(2-pyrazin-2-ylethynyl)-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [2-(2,6-dimethylmorpholin-4-yl)-6-fluoro-5-(2-pyrazin-2-ylethynyl)-3-pyridinyl]methanol |
| PubChem CID | 77265974 |
| Molecular Formula | C18H19FN4O2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | [2-(2,6-dimethylmorpholin-4-yl)-6-fluoro-5-(2-pyrazin-2-ylethynyl)-3-pyridinyl]methanol |
| SMILES | CC1CN(c2nc(F)c(C#Cc3cnccn3)cc2CO)CC(C)O1 |
| InChI | InChI=1S/C18H19FN4O2/c1-12-9-23(10-13(2)25-12)18-15(11-24)7-14(17(19)22-18)3-4-16-8-20-5-6-21-16/h5-8,12-13,24H,9-11H2,1-2H3 |
| InChIKey | FJJAFLXWUVACDJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 71.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,6-dimethylmorpholin-4-yl)-6-fluoro-5-(2-pyrazin-2-ylethynyl)-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-dimethylmorpholin-4-yl)-6-fluoro-5-(2-pyrazin-2-ylethynyl)-3-pyridinyl]methanol?
The IUPAC name of [2-(2,6-dimethylmorpholin-4-yl)-6-fluoro-5-(2-pyrazin-2-ylethynyl)-3-pyridinyl]methanol (CID 77265974) is [2-(2,6-dimethylmorpholin-4-yl)-6-fluoro-5-(2-pyrazin-2-ylethynyl)-3-pyridinyl]methanol.
What is the SMILES notation for [2-(2,6-dimethylmorpholin-4-yl)-6-fluoro-5-(2-pyrazin-2-ylethynyl)-3-pyridinyl]methanol?
The canonical SMILES for [2-(2,6-dimethylmorpholin-4-yl)-6-fluoro-5-(2-pyrazin-2-ylethynyl)-3-pyridinyl]methanol is CC1CN(c2nc(F)c(C#Cc3cnccn3)cc2CO)CC(C)O1.
What is the InChIKey of [2-(2,6-dimethylmorpholin-4-yl)-6-fluoro-5-(2-pyrazin-2-ylethynyl)-3-pyridinyl]methanol?
The InChIKey is FJJAFLXWUVACDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FN4O2/c1-12-9-23(10-13(2)25-12)18-15(11-24)7-14(17(19)22-18)3-4-16-8-20-5-6-21-16/h5-8,12-13,24H,9-11H2,1-2H3.
What are the key properties of [2-(2,6-dimethylmorpholin-4-yl)-6-fluoro-5-(2-pyrazin-2-ylethynyl)-3-pyridinyl]methanol?
[2-(2,6-dimethylmorpholin-4-yl)-6-fluoro-5-(2-pyrazin-2-ylethynyl)-3-pyridinyl]methanol has a molecular weight of 342.37 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-dimethylmorpholin-4-yl)-6-fluoro-5-(2-pyrazin-2-ylethynyl)-3-pyridinyl]methanol is sourced from PubChem (CID 77265974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).