C14H22N4O4 — CID 77267129
benzene-1,3-dicarboxamide;2,6-diaminohexanoic acid (PubChem CID 77267129) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is benzene-1,3-dicarboxamide;2,6-diaminohexanoic acid.
| Compound Name | benzene-1,3-dicarboxamide;2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 77267129 |
| Molecular Formula | C14H22N4O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | benzene-1,3-dicarboxamide;2,6-diaminohexanoic acid |
| SMILES | NC(=O)c1cccc(C(N)=O)c1.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C8H8N2O2.C6H14N2O2/c9-7(11)5-2-1-3-6(4-5)8(10)12;7-4-2-1-3-5(8)6(9)10/h1-4H,(H2,9,11)(H2,10,12);5H,1-4,7-8H2,(H,9,10) |
| InChIKey | BTRUEZIQYCDSPL-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 175.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|