C24H32N8O2 — CID 77271598
6-[4-[[13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]methyl]piperidin-1-yl]pyridine-3-carboxamide (PubChem CID 77271598) has the molecular formula C24H32N8O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is 6-[4-[[13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]methyl]piperidin-1-yl]pyridine-3-carboxamide.
| Compound Name | 6-[4-[[13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]methyl]piperidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 77271598 |
| Molecular Formula | C24H32N8O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 6-[4-[[13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]methyl]piperidin-1-yl]pyridine-3-carboxamide |
| SMILES | CCNc1ncc2c(n1)N1CCCC1CN(CC1CCN(c3ccc(C(N)=O)cn3)CC1)C2=O |
| InChI | InChI=1S/C24H32N8O2/c1-2-26-24-28-13-19-22(29-24)32-9-3-4-18(32)15-31(23(19)34)14-16-7-10-30(11-8-16)20-6-5-17(12-27-20)21(25)33/h5-6,12-13,16,18H,2-4,7-11,14-15H2,1H3,(H2,25,33)(H,26,28,29) |
| InChIKey | MMMCFGLXIATIKU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |