C14H29N9O4S3 — CID 77273266
2,6-diaminohexanoic acid;3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide (PubChem CID 77273266) has the molecular formula C14H29N9O4S3 and a molecular weight of 483.65 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide.
| Compound Name | 2,6-diaminohexanoic acid;3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide |
|---|---|
| PubChem CID | 77273266 |
| Molecular Formula | C14H29N9O4S3 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 2,6-diaminohexanoic acid;3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide |
| SMILES | NC(N)=Nc1nc(CSCCC(N)=NS(N)(=O)=O)cs1.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C8H15N7O2S3.C6H14N2O2/c9-6(15-20(12,16)17)1-2-18-3-5-4-19-8(13-5)14-7(10)11;7-4-2-1-3-5(8)6(9)10/h4H,1-3H2,(H2,9,15)(H2,12,16,17)(H4,10,11,13,14);5H,1-4,7-8H2,(H,9,10) |
| InChIKey | RIHZKVMOJDDFIA-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 265.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|