C26H23Cl2FN4O — CID 77273371
[4-[3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]-piperazin-1-ylmethanone (PubChem CID 77273371) has the molecular formula C26H23Cl2FN4O and a molecular weight of 497.40 g/mol. Its IUPAC name is [4-[3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]-piperazin-1-ylmethanone.
| Compound Name | [4-[3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 77273371 |
| Molecular Formula | C26H23Cl2FN4O |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | [4-[3-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]-piperazin-1-ylmethanone |
| SMILES | CC(c1c(Cl)ccc(F)c1Cl)c1c[nH]c2ncc(-c3ccc(C(=O)N4CCNCC4)cc3)cc12 |
| InChI | InChI=1S/C26H23Cl2FN4O/c1-15(23-21(27)6-7-22(29)24(23)28)20-14-32-25-19(20)12-18(13-31-25)16-2-4-17(5-3-16)26(34)33-10-8-30-9-11-33/h2-7,12-15,30H,8-11H2,1H3,(H,31,32) |
| InChIKey | WZUOMIRVPRQOES-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|