C19H14O5S — CID 7728134
(2-oxo-2-thiophen-2-ylethyl) 5-(4-acetylphenyl)furan-2-carboxylate (PubChem CID 7728134) has the molecular formula C19H14O5S and a molecular weight of 354.38 g/mol. Its IUPAC name is (2-oxo-2-thiophen-2-ylethyl) 5-(4-acetylphenyl)furan-2-carboxylate.
| Compound Name | (2-oxo-2-thiophen-2-ylethyl) 5-(4-acetylphenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 7728134 |
| Molecular Formula | C19H14O5S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | (2-oxo-2-thiophen-2-ylethyl) 5-(4-acetylphenyl)furan-2-carboxylate |
| SMILES | CC(=O)c1ccc(-c2ccc(C(=O)OCC(=O)c3cccs3)o2)cc1 |
| InChI | InChI=1S/C19H14O5S/c1-12(20)13-4-6-14(7-5-13)16-8-9-17(24-16)19(22)23-11-15(21)18-3-2-10-25-18/h2-10H,11H2,1H3 |
| InChIKey | UPVUSVJPZBPDKP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |