C19H27N3O3S2 — CID 77287636
2-[2-[2-[[2-(cyclohexen-1-yl)ethylamino]methyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 77287636) has the molecular formula C19H27N3O3S2 and a molecular weight of 409.58 g/mol. Its IUPAC name is 2-[2-[2-[[2-(cyclohexen-1-yl)ethylamino]methyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[2-[[2-(cyclohexen-1-yl)ethylamino]methyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 77287636 |
| Molecular Formula | C19H27N3O3S2 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 2-[2-[2-[[2-(cyclohexen-1-yl)ethylamino]methyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(SCCN2C(=O)CCC2CNCCC2=CCCCC2)n1 |
| InChI | InChI=1S/C19H27N3O3S2/c23-17-7-6-15(12-20-9-8-14-4-2-1-3-5-14)22(17)10-11-26-19-21-16(13-27-19)18(24)25/h4,13,15,20H,1-3,5-12H2,(H,24,25) |
| InChIKey | LENYBUHUEFFBSA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|