C26H30FN5O6 — CID 77291413
N-(cyclohexylmethyl)-17'-fluoro-4',6'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-13'-carboxamide (PubChem CID 77291413) has the molecular formula C26H30FN5O6 and a molecular weight of 527.55 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-17'-fluoro-4',6'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-13'-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-17'-fluoro-4',6'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-13'-carboxamide |
|---|---|
| PubChem CID | 77291413 |
| Molecular Formula | C26H30FN5O6 |
| Molecular Weight | 527.55 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | N-(cyclohexylmethyl)-17'-fluoro-4',6'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-13'-carboxamide |
| SMILES | CC1CN2c3c(cc4c(C(=O)NCC5CCCCC5)noc4c3F)CC3(C(=O)NC(=O)NC3=O)C2C(C)O1 |
| InChI | InChI=1S/C26H30FN5O6/c1-12-11-32-19-15(9-26(21(32)13(2)37-12)23(34)29-25(36)30-24(26)35)8-16-18(31-38-20(16)17(19)27)22(33)28-10-14-6-4-3-5-7-14/h8,12-14,21H,3-7,9-11H2,1-2H3,(H,28,33)(H2,29,30,34,35,36) |
| InChIKey | XKZVGNGZFOYOQU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 142.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|