C23H21FN6O — CID 77291666
4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 77291666) has the molecular formula C23H21FN6O and a molecular weight of 416.46 g/mol. Its IUPAC name is 4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | 4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 77291666 |
| Molecular Formula | C23H21FN6O |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2cn(Cc3ccc(-c4cccc(F)n4)cc3)nc2N2C1=NC1CCCC12 |
| InChI | InChI=1S/C23H21FN6O/c1-28-22(31)16-13-29(27-21(16)30-19-6-2-5-18(19)26-23(28)30)12-14-8-10-15(11-9-14)17-4-3-7-20(24)25-17/h3-4,7-11,13,18-19H,2,5-6,12H2,1H3 |
| InChIKey | CLYUHPLWQDZZSS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 66.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|