C10H18FNO3 — CID 77293236
2-tert-butyl-4-fluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylic acid (PubChem CID 77293236) has the molecular formula C10H18FNO3 and a molecular weight of 219.26 g/mol. Its IUPAC name is 2-tert-butyl-4-fluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-4-fluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 77293236 |
| Molecular Formula | C10H18FNO3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-tert-butyl-4-fluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylic acid |
| SMILES | CC(C)(C)C1(CO)CC(F)CN1C(=O)O |
| InChI | InChI=1S/C10H18FNO3/c1-9(2,3)10(6-13)4-7(11)5-12(10)8(14)15/h7,13H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | GCDLQZSPEFZZJY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |