About 1-bromo-4-methoxybenzene
1-bromo-4-methoxybenzene (PubChem CID 7730) has the molecular formula C7H7BrO
and a molecular weight of 187.04 g/mol. Its IUPAC name is 1-bromo-4-methoxybenzene.
Molecular Properties
| Compound Name | 1-bromo-4-methoxybenzene |
| PubChem CID | 7730 |
| Molecular Formula | C7H7BrO |
| Molecular Weight | 187.04 g/mol |
| Exact Mass | 185.97 |
| IUPAC Name | 1-bromo-4-methoxybenzene |
| SMILES | COc1ccc(Br)cc1 |
| InChI | InChI=1S/C7H7BrO/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3 |
| InChIKey | QJPJQTDYNZXKQF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.04 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-4-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-methoxybenzene?
The IUPAC name of 1-bromo-4-methoxybenzene (CID 7730) is 1-bromo-4-methoxybenzene.
What is the SMILES notation for 1-bromo-4-methoxybenzene?
The canonical SMILES for 1-bromo-4-methoxybenzene is COc1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-methoxybenzene?
The InChIKey is QJPJQTDYNZXKQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrO/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3.
What are the key properties of 1-bromo-4-methoxybenzene?
1-bromo-4-methoxybenzene has a molecular weight of 187.04 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-methoxybenzene is sourced from PubChem (CID 7730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).