C15H10Cl2N2O2S — CID 7730111
(5E)-3-(3,4-dichlorophenyl)-5-[(1-methylpyrrol-2-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 7730111) has the molecular formula C15H10Cl2N2O2S and a molecular weight of 353.23 g/mol. Its IUPAC name is (5E)-3-(3,4-dichlorophenyl)-5-[(1-methylpyrrol-2-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-(3,4-dichlorophenyl)-5-[(1-methylpyrrol-2-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 7730111 |
| Molecular Formula | C15H10Cl2N2O2S |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | (5E)-3-(3,4-dichlorophenyl)-5-[(1-methylpyrrol-2-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cn1cccc1/C=C1/SC(=O)N(c2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C15H10Cl2N2O2S/c1-18-6-2-3-9(18)8-13-14(20)19(15(21)22-13)10-4-5-11(16)12(17)7-10/h2-8H,1H3/b13-8+ |
| InChIKey | IUHKCBWLXWNCMM-MDWZMJQESA-N |
| XLogP | 4.57 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|