C17H22N4S — CID 77301934
2-methyl-N-[6-(4-methylthiophen-3-yl)pyridazin-3-yl]-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 77301934) has the molecular formula C17H22N4S and a molecular weight of 314.46 g/mol. Its IUPAC name is 2-methyl-N-[6-(4-methylthiophen-3-yl)pyridazin-3-yl]-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | 2-methyl-N-[6-(4-methylthiophen-3-yl)pyridazin-3-yl]-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 77301934 |
| Molecular Formula | C17H22N4S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-methyl-N-[6-(4-methylthiophen-3-yl)pyridazin-3-yl]-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | Cc1cscc1-c1ccc(NC2C3CCN(CC3)C2C)nn1 |
| InChI | InChI=1S/C17H22N4S/c1-11-9-22-10-14(11)15-3-4-16(20-19-15)18-17-12(2)21-7-5-13(17)6-8-21/h3-4,9-10,12-13,17H,5-8H2,1-2H3,(H,18,20) |
| InChIKey | HYKPTPXDJJWUCJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |