About N-[6-(3,4-dimethylphenyl)-3-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine
N-[6-(3,4-dimethylphenyl)-3-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 77302098) has the molecular formula C21H27N3
and a molecular weight of 321.47 g/mol. Its IUPAC name is N-[6-(3,4-dimethylphenyl)-3-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine.
Molecular Properties
| Compound Name | N-[6-(3,4-dimethylphenyl)-3-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine |
| PubChem CID | 77302098 |
| Molecular Formula | C21H27N3 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | N-[6-(3,4-dimethylphenyl)-3-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | Cc1ccc(-c2ccc(NC3C4CCN(CC4)C3C)cn2)cc1C |
| InChI | InChI=1S/C21H27N3/c1-14-4-5-18(12-15(14)2)20-7-6-19(13-22-20)23-21-16(3)24-10-8-17(21)9-11-24/h4-7,12-13,16-17,21,23H,8-11H2,1-3H3 |
| InChIKey | URGBSTJFJUBVBE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[6-(3,4-dimethylphenyl)-3-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(3,4-dimethylphenyl)-3-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine?
The IUPAC name of N-[6-(3,4-dimethylphenyl)-3-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine (CID 77302098) is N-[6-(3,4-dimethylphenyl)-3-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine.
What is the SMILES notation for N-[6-(3,4-dimethylphenyl)-3-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine?
The canonical SMILES for N-[6-(3,4-dimethylphenyl)-3-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine is Cc1ccc(-c2ccc(NC3C4CCN(CC4)C3C)cn2)cc1C.
What is the InChIKey of N-[6-(3,4-dimethylphenyl)-3-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine?
The InChIKey is URGBSTJFJUBVBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3/c1-14-4-5-18(12-15(14)2)20-7-6-19(13-22-20)23-21-16(3)24-10-8-17(21)9-11-24/h4-7,12-13,16-17,21,23H,8-11H2,1-3H3.
What are the key properties of N-[6-(3,4-dimethylphenyl)-3-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine?
N-[6-(3,4-dimethylphenyl)-3-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine has a molecular weight of 321.47 g/mol, XLogP of 4.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(3,4-dimethylphenyl)-3-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine is sourced from PubChem (CID 77302098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).