C21H12N2O5S — CID 7730438
4-[(8-oxo-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-14-yl)sulfonyl]benzoic acid (PubChem CID 7730438) has the molecular formula C21H12N2O5S and a molecular weight of 404.40 g/mol. Its IUPAC name is 4-[(8-oxo-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-14-yl)sulfonyl]benzoic acid.
| Compound Name | 4-[(8-oxo-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-14-yl)sulfonyl]benzoic acid |
|---|---|
| PubChem CID | 7730438 |
| Molecular Formula | C21H12N2O5S |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 4-[(8-oxo-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-14-yl)sulfonyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)n2nc3c4c(cccc42)C(=O)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C21H12N2O5S/c24-20-15-5-2-1-4-14(15)19-18-16(20)6-3-7-17(18)23(22-19)29(27,28)13-10-8-12(9-11-13)21(25)26/h1-11H,(H,25,26) |
| InChIKey | IJQCZKPWAGCGJL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |