C18H34N3+ — CID 77305294
7-(cyclodecen-1-yl)-6-methyl-1,2,3,4,5,8,9,10-octahydro-1,4,7-triazecin-7-ium (PubChem CID 77305294) has the molecular formula C18H34N3+ and a molecular weight of 292.49 g/mol. Its IUPAC name is 7-(cyclodecen-1-yl)-6-methyl-1,2,3,4,5,8,9,10-octahydro-1,4,7-triazecin-7-ium.
| Compound Name | 7-(cyclodecen-1-yl)-6-methyl-1,2,3,4,5,8,9,10-octahydro-1,4,7-triazecin-7-ium |
|---|---|
| PubChem CID | 77305294 |
| Molecular Formula | C18H34N3+ |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.27 |
| IUPAC Name | 7-(cyclodecen-1-yl)-6-methyl-1,2,3,4,5,8,9,10-octahydro-1,4,7-triazecin-7-ium |
| SMILES | C/C1=[N+](\C2=CCCCCCCCC2)CCCNCCNC1 |
| InChI | InChI=1S/C18H34N3/c1-17-16-20-14-13-19-12-9-15-21(17)18-10-7-5-3-2-4-6-8-11-18/h10,19-20H,2-9,11-16H2,1H3/q+1/b18-10?,21-17+ |
| InChIKey | FXUVFWKNVHXODA-JRLQIWNFSA-N |
| XLogP | 3.06 |
| TPSA | 27.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|