C17H16N2O2S3 — CID 7731083
(5S)-5-methyl-3-(4-methylphenyl)sulfonyl-2-phenylimino-1,3-thiazolidine-4-thione (PubChem CID 7731083) has the molecular formula C17H16N2O2S3 and a molecular weight of 376.53 g/mol. Its IUPAC name is (5S)-5-methyl-3-(4-methylphenyl)sulfonyl-2-phenylimino-1,3-thiazolidine-4-thione.
| Compound Name | (5S)-5-methyl-3-(4-methylphenyl)sulfonyl-2-phenylimino-1,3-thiazolidine-4-thione |
|---|---|
| PubChem CID | 7731083 |
| Molecular Formula | C17H16N2O2S3 |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | (5S)-5-methyl-3-(4-methylphenyl)sulfonyl-2-phenylimino-1,3-thiazolidine-4-thione |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=S)[C@H](C)S/C2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C17H16N2O2S3/c1-12-8-10-15(11-9-12)24(20,21)19-16(22)13(2)23-17(19)18-14-6-4-3-5-7-14/h3-11,13H,1-2H3/b18-17-/t13-/m0/s1 |
| InChIKey | GNYOTRZUNFNYDN-FKEVTRRJSA-N |
| XLogP | 4.14 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|