C15H13F2NOS — CID 7731668
N-[4-(difluoromethylsulfanyl)phenyl]-3-methylbenzamide (PubChem CID 7731668) has the molecular formula C15H13F2NOS and a molecular weight of 293.34 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-3-methylbenzamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 7731668 |
| Molecular Formula | C15H13F2NOS |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(SC(F)F)cc2)c1 |
| InChI | InChI=1S/C15H13F2NOS/c1-10-3-2-4-11(9-10)14(19)18-12-5-7-13(8-6-12)20-15(16)17/h2-9,15H,1H3,(H,18,19) |
| InChIKey | WKRMUCLTQPILSM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |