About 4-methoxyaniline
4-methoxyaniline (PubChem CID 7732) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is 4-methoxyaniline.
Molecular Properties
| Compound Name | 4-methoxyaniline |
| PubChem CID | 7732 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 4-methoxyaniline |
| SMILES | COc1ccc(N)cc1 |
| InChI | InChI=1S/C7H9NO/c1-9-7-4-2-6(8)3-5-7/h2-5H,8H2,1H3 |
| InChIKey | BHAAPTBBJKJZER-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxyaniline?
The IUPAC name of 4-methoxyaniline (CID 7732) is 4-methoxyaniline.
What is the SMILES notation for 4-methoxyaniline?
The canonical SMILES for 4-methoxyaniline is COc1ccc(N)cc1.
What is the InChIKey of 4-methoxyaniline?
The InChIKey is BHAAPTBBJKJZER-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO/c1-9-7-4-2-6(8)3-5-7/h2-5H,8H2,1H3.
What are the key properties of 4-methoxyaniline?
4-methoxyaniline has a molecular weight of 123.15 g/mol, XLogP of 1.28, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxyaniline is sourced from PubChem (CID 7732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).