C21H21N3O2 — CID 773201
N-[[4-(dimethylamino)phenyl]methylideneamino]-2-naphthalen-1-yloxyacetamide (PubChem CID 773201) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methylideneamino]-2-naphthalen-1-yloxyacetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methylideneamino]-2-naphthalen-1-yloxyacetamide |
|---|---|
| PubChem CID | 773201 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methylideneamino]-2-naphthalen-1-yloxyacetamide |
| SMILES | CN(C)c1ccc(C=NNC(=O)COc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C21H21N3O2/c1-24(2)18-12-10-16(11-13-18)14-22-23-21(25)15-26-20-9-5-7-17-6-3-4-8-19(17)20/h3-14H,15H2,1-2H3,(H,23,25) |
| InChIKey | LMZMTMSSQUWBHP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|