C24H26ClNO3 — CID 77322675
ethyl 2-[4-(4-chlorophenyl)phenyl]-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoline-3-carboxylate (PubChem CID 77322675) has the molecular formula C24H26ClNO3 and a molecular weight of 411.93 g/mol. Its IUPAC name is ethyl 2-[4-(4-chlorophenyl)phenyl]-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 2-[4-(4-chlorophenyl)phenyl]-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 77322675 |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | ethyl 2-[4-(4-chlorophenyl)phenyl]-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C2CCCCC2NC1c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H26ClNO3/c1-2-29-24(28)21-22(26-20-6-4-3-5-19(20)23(21)27)17-9-7-15(8-10-17)16-11-13-18(25)14-12-16/h7-14,19-22,26H,2-6H2,1H3 |
| InChIKey | YLSSBCUXRYBZQS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|