C15H20FN — CID 77324450
4-(4-fluorophenyl)-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 77324450) has the molecular formula C15H20FN and a molecular weight of 233.33 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | 4-(4-fluorophenyl)-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 77324450 |
| Molecular Formula | C15H20FN |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 4-(4-fluorophenyl)-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CN1CC2CCCC(c3ccc(F)cc3)C2C1 |
| InChI | InChI=1S/C15H20FN/c1-17-9-12-3-2-4-14(15(12)10-17)11-5-7-13(16)8-6-11/h5-8,12,14-15H,2-4,9-10H2,1H3 |
| InChIKey | JYIYKMKZZDVSJT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |