About 2-methylpropyl 3-(furan-2-yl)propanoate
2-methylpropyl 3-(furan-2-yl)propanoate (PubChem CID 7733) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-methylpropyl 3-(furan-2-yl)propanoate.
Molecular Properties
| Compound Name | 2-methylpropyl 3-(furan-2-yl)propanoate |
| PubChem CID | 7733 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2-methylpropyl 3-(furan-2-yl)propanoate |
| SMILES | CC(C)COC(=O)CCc1ccco1 |
| InChI | InChI=1S/C11H16O3/c1-9(2)8-14-11(12)6-5-10-4-3-7-13-10/h3-4,7,9H,5-6,8H2,1-2H3 |
| InChIKey | SVDPTFHRRNUNRS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpropyl 3-(furan-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 3-(furan-2-yl)propanoate?
The IUPAC name of 2-methylpropyl 3-(furan-2-yl)propanoate (CID 7733) is 2-methylpropyl 3-(furan-2-yl)propanoate.
What is the SMILES notation for 2-methylpropyl 3-(furan-2-yl)propanoate?
The canonical SMILES for 2-methylpropyl 3-(furan-2-yl)propanoate is CC(C)COC(=O)CCc1ccco1.
What is the InChIKey of 2-methylpropyl 3-(furan-2-yl)propanoate?
The InChIKey is SVDPTFHRRNUNRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-9(2)8-14-11(12)6-5-10-4-3-7-13-10/h3-4,7,9H,5-6,8H2,1-2H3.
What are the key properties of 2-methylpropyl 3-(furan-2-yl)propanoate?
2-methylpropyl 3-(furan-2-yl)propanoate has a molecular weight of 196.25 g/mol, XLogP of 2.41, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 3-(furan-2-yl)propanoate is sourced from PubChem (CID 7733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).