C5H10N2 — CID 77335107
2-methyl-2,5-dihydropyrrol-1-amine (PubChem CID 77335107) has the molecular formula C5H10N2 and a molecular weight of 98.15 g/mol. Its IUPAC name is 2-methyl-2,5-dihydropyrrol-1-amine.
| Compound Name | 2-methyl-2,5-dihydropyrrol-1-amine |
|---|---|
| PubChem CID | 77335107 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 2-methyl-2,5-dihydropyrrol-1-amine |
| SMILES | CC1C=CCN1N |
| InChI | InChI=1S/C5H10N2/c1-5-3-2-4-7(5)6/h2-3,5H,4,6H2,1H3 |
| InChIKey | WQNRTKRVKZYDDY-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|