About 1-(1-hydroxycyclohexa-2,4-dien-1-yl)butan-1-one
1-(1-hydroxycyclohexa-2,4-dien-1-yl)butan-1-one (PubChem CID 77335775) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-(1-hydroxycyclohexa-2,4-dien-1-yl)butan-1-one.
Molecular Properties
| Compound Name | 1-(1-hydroxycyclohexa-2,4-dien-1-yl)butan-1-one |
| PubChem CID | 77335775 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 1-(1-hydroxycyclohexa-2,4-dien-1-yl)butan-1-one |
| SMILES | CCCC(=O)C1(O)C=CC=CC1 |
| InChI | InChI=1S/C10H14O2/c1-2-6-9(11)10(12)7-4-3-5-8-10/h3-5,7,12H,2,6,8H2,1H3 |
| InChIKey | DXNDIMOQYQLENW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-hydroxycyclohexa-2,4-dien-1-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-hydroxycyclohexa-2,4-dien-1-yl)butan-1-one?
The IUPAC name of 1-(1-hydroxycyclohexa-2,4-dien-1-yl)butan-1-one (CID 77335775) is 1-(1-hydroxycyclohexa-2,4-dien-1-yl)butan-1-one.
What is the SMILES notation for 1-(1-hydroxycyclohexa-2,4-dien-1-yl)butan-1-one?
The canonical SMILES for 1-(1-hydroxycyclohexa-2,4-dien-1-yl)butan-1-one is CCCC(=O)C1(O)C=CC=CC1.
What is the InChIKey of 1-(1-hydroxycyclohexa-2,4-dien-1-yl)butan-1-one?
The InChIKey is DXNDIMOQYQLENW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-2-6-9(11)10(12)7-4-3-5-8-10/h3-5,7,12H,2,6,8H2,1H3.
What are the key properties of 1-(1-hydroxycyclohexa-2,4-dien-1-yl)butan-1-one?
1-(1-hydroxycyclohexa-2,4-dien-1-yl)butan-1-one has a molecular weight of 166.22 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-hydroxycyclohexa-2,4-dien-1-yl)butan-1-one is sourced from PubChem (CID 77335775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).