C22H24N2O2 — CID 773438
2-cyano-N-(3,5-dimethylphenyl)-3-[4-(2-methylpropoxy)phenyl]prop-2-enamide (PubChem CID 773438) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-cyano-N-(3,5-dimethylphenyl)-3-[4-(2-methylpropoxy)phenyl]prop-2-enamide.
| Compound Name | 2-cyano-N-(3,5-dimethylphenyl)-3-[4-(2-methylpropoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 773438 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-cyano-N-(3,5-dimethylphenyl)-3-[4-(2-methylpropoxy)phenyl]prop-2-enamide |
| SMILES | Cc1cc(C)cc(NC(=O)C(C#N)=Cc2ccc(OCC(C)C)cc2)c1 |
| InChI | InChI=1S/C22H24N2O2/c1-15(2)14-26-21-7-5-18(6-8-21)12-19(13-23)22(25)24-20-10-16(3)9-17(4)11-20/h5-12,15H,14H2,1-4H3,(H,24,25) |
| InChIKey | HFUZOZZYRAVPGY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|