About [4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-ethylcyanamide
[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-ethylcyanamide (PubChem CID 773462) has the molecular formula C10H17N7
and a molecular weight of 235.29 g/mol. Its IUPAC name is [4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-ethylcyanamide.
Molecular Properties
| Compound Name | [4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-ethylcyanamide |
| PubChem CID | 773462 |
| Molecular Formula | C10H17N7 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | [4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-ethylcyanamide |
| SMILES | CCN(C#N)c1nc(N(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C10H17N7/c1-6-17(7-11)10-13-8(15(2)3)12-9(14-10)16(4)5/h6H2,1-5H3 |
| InChIKey | LSAYWPZWLZUUMK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 72.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze [4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-ethylcyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-ethylcyanamide?
The IUPAC name of [4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-ethylcyanamide (CID 773462) is [4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-ethylcyanamide.
What is the SMILES notation for [4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-ethylcyanamide?
The canonical SMILES for [4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-ethylcyanamide is CCN(C#N)c1nc(N(C)C)nc(N(C)C)n1.
What is the InChIKey of [4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-ethylcyanamide?
The InChIKey is LSAYWPZWLZUUMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N7/c1-6-17(7-11)10-13-8(15(2)3)12-9(14-10)16(4)5/h6H2,1-5H3.
What are the key properties of [4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-ethylcyanamide?
[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-ethylcyanamide has a molecular weight of 235.29 g/mol, XLogP of 0.31, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-ethylcyanamide is sourced from PubChem (CID 773462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).