About 1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3,3-dimethylurea
1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3,3-dimethylurea (PubChem CID 7735643) has the molecular formula C9H18N2O3S
and a molecular weight of 234.32 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3,3-dimethylurea.
Molecular Properties
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3,3-dimethylurea |
| PubChem CID | 7735643 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3,3-dimethylurea |
| SMILES | CCN(C(=O)N(C)C)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H18N2O3S/c1-4-11(9(12)10(2)3)8-5-6-15(13,14)7-8/h8H,4-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | OUGCBKYYHPRRRG-QMMMGPOBSA-N |
| XLogP | 0.18 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3,3-dimethylurea?
The IUPAC name of 1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3,3-dimethylurea (CID 7735643) is 1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3,3-dimethylurea.
What is the SMILES notation for 1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3,3-dimethylurea?
The canonical SMILES for 1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3,3-dimethylurea is CCN(C(=O)N(C)C)[C@H]1CCS(=O)(=O)C1.
What is the InChIKey of 1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3,3-dimethylurea?
The InChIKey is OUGCBKYYHPRRRG-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H18N2O3S/c1-4-11(9(12)10(2)3)8-5-6-15(13,14)7-8/h8H,4-7H2,1-3H3/t8-/m0/s1.
What are the key properties of 1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3,3-dimethylurea?
1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3,3-dimethylurea has a molecular weight of 234.32 g/mol, XLogP of 0.18, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethyl-3,3-dimethylurea is sourced from PubChem (CID 7735643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).