C17H18N2O2S — CID 773571
2-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-benzimidazole (PubChem CID 773571) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-benzimidazole.
| Compound Name | 2-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 773571 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-benzimidazole |
| SMILES | Cc1ccc(S(=O)(=O)CCc2nc3ccccc3[nH]2)cc1C |
| InChI | InChI=1S/C17H18N2O2S/c1-12-7-8-14(11-13(12)2)22(20,21)10-9-17-18-15-5-3-4-6-16(15)19-17/h3-8,11H,9-10H2,1-2H3,(H,18,19) |
| InChIKey | JRONSNABUXYHLR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |