About [(1S)-2-oxocyclohexyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate
[(1S)-2-oxocyclohexyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate (PubChem CID 7735964) has the molecular formula C17H17FO4S
and a molecular weight of 336.38 g/mol. Its IUPAC name is [(1S)-2-oxocyclohexyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate.
Molecular Properties
| Compound Name | [(1S)-2-oxocyclohexyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate |
| PubChem CID | 7735964 |
| Molecular Formula | C17H17FO4S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | [(1S)-2-oxocyclohexyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate |
| SMILES | COCc1c(C(=O)O[C@H]2CCCCC2=O)sc2cccc(F)c12 |
| InChI | InChI=1S/C17H17FO4S/c1-21-9-10-15-11(18)5-4-8-14(15)23-16(10)17(20)22-13-7-3-2-6-12(13)19/h4-5,8,13H,2-3,6-7,9H2,1H3/t13-/m0/s1 |
| InChIKey | WGPNDZIVEGKZHU-ZDUSSCGKSA-N |
| XLogP | 3.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1S)-2-oxocyclohexyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2-oxocyclohexyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate?
The IUPAC name of [(1S)-2-oxocyclohexyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate (CID 7735964) is [(1S)-2-oxocyclohexyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate.
What is the SMILES notation for [(1S)-2-oxocyclohexyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate?
The canonical SMILES for [(1S)-2-oxocyclohexyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate is COCc1c(C(=O)O[C@H]2CCCCC2=O)sc2cccc(F)c12.
What is the InChIKey of [(1S)-2-oxocyclohexyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate?
The InChIKey is WGPNDZIVEGKZHU-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H17FO4S/c1-21-9-10-15-11(18)5-4-8-14(15)23-16(10)17(20)22-13-7-3-2-6-12(13)19/h4-5,8,13H,2-3,6-7,9H2,1H3/t13-/m0/s1.
What are the key properties of [(1S)-2-oxocyclohexyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate?
[(1S)-2-oxocyclohexyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate has a molecular weight of 336.38 g/mol, XLogP of 3.86, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2-oxocyclohexyl] 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 7735964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).