C24H24O5 — CID 77359834
2-[6-[(4-pent-4-enoyl-2,3-dihydro-1H-inden-1-yl)oxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid (PubChem CID 77359834) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is 2-[6-[(4-pent-4-enoyl-2,3-dihydro-1H-inden-1-yl)oxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid.
| Compound Name | 2-[6-[(4-pent-4-enoyl-2,3-dihydro-1H-inden-1-yl)oxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
|---|---|
| PubChem CID | 77359834 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-[6-[(4-pent-4-enoyl-2,3-dihydro-1H-inden-1-yl)oxy]-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
| SMILES | C=CCCC(=O)c1cccc2c1CCC2Oc1ccc2c(c1)OCC2CC(=O)O |
| InChI | InChI=1S/C24H24O5/c1-2-3-7-21(25)19-5-4-6-20-18(19)10-11-22(20)29-16-8-9-17-15(12-24(26)27)14-28-23(17)13-16/h2,4-6,8-9,13,15,22H,1,3,7,10-12,14H2,(H,26,27) |
| InChIKey | VGBZYBZXYDQQFL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|