About N-[1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine
N-[1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine (PubChem CID 77360457) has the molecular formula C19H21FN2O2
and a molecular weight of 328.39 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine.
Molecular Properties
| Compound Name | N-[1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine |
| PubChem CID | 77360457 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-[1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine |
| SMILES | CC(NC1CCC(c2ccc(F)nc2)C1)c1cccc2c1OCO2 |
| InChI | InChI=1S/C19H21FN2O2/c1-12(16-3-2-4-17-19(16)24-11-23-17)22-15-7-5-13(9-15)14-6-8-18(20)21-10-14/h2-4,6,8,10,12-13,15,22H,5,7,9,11H2,1H3 |
| InChIKey | ZAXZWGSLUSCDND-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine?
The IUPAC name of N-[1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine (CID 77360457) is N-[1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine.
What is the SMILES notation for N-[1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine?
The canonical SMILES for N-[1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine is CC(NC1CCC(c2ccc(F)nc2)C1)c1cccc2c1OCO2.
What is the InChIKey of N-[1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine?
The InChIKey is ZAXZWGSLUSCDND-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21FN2O2/c1-12(16-3-2-4-17-19(16)24-11-23-17)22-15-7-5-13(9-15)14-6-8-18(20)21-10-14/h2-4,6,8,10,12-13,15,22H,5,7,9,11H2,1H3.
What are the key properties of N-[1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine?
N-[1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine has a molecular weight of 328.39 g/mol, XLogP of 3.94, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1,3-benzodioxol-4-yl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine is sourced from PubChem (CID 77360457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).