C41H43N3O8 — CID 77362209
1-[5-acetyl-6-[4-(4,4-diphenylpiperidin-1-yl)butyl]-2-methyl-4-(3-nitrophenyl)-3-pyridinyl]ethanone;but-2-enedioic acid (PubChem CID 77362209) has the molecular formula C41H43N3O8 and a molecular weight of 705.81 g/mol. Its IUPAC name is 1-[5-acetyl-6-[4-(4,4-diphenylpiperidin-1-yl)butyl]-2-methyl-4-(3-nitrophenyl)-3-pyridinyl]ethanone;but-2-enedioic acid.
| Compound Name | 1-[5-acetyl-6-[4-(4,4-diphenylpiperidin-1-yl)butyl]-2-methyl-4-(3-nitrophenyl)-3-pyridinyl]ethanone;but-2-enedioic acid |
|---|---|
| PubChem CID | 77362209 |
| Molecular Formula | C41H43N3O8 |
| Molecular Weight | 705.81 g/mol |
| Exact Mass | 705.31 |
| IUPAC Name | 1-[5-acetyl-6-[4-(4,4-diphenylpiperidin-1-yl)butyl]-2-methyl-4-(3-nitrophenyl)-3-pyridinyl]ethanone;but-2-enedioic acid |
| SMILES | CC(=O)c1c(C)nc(CCCCN2CCC(c3ccccc3)(c3ccccc3)CC2)c(C(C)=O)c1-c1cccc([N+](=O)[O-])c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C37H39N3O4.C4H4O4/c1-26-34(27(2)41)36(29-13-12-18-32(25-29)40(43)44)35(28(3)42)33(38-26)19-10-11-22-39-23-20-37(21-24-39,30-14-6-4-7-15-30)31-16-8-5-9-17-31;5-3(6)1-2-4(7)8/h4-9,12-18,25H,10-11,19-24H2,1-3H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | XRAQKWITLTVVNX-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 168.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.81 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|