C20H23ClFNO3 — CID 7736365
[(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate (PubChem CID 7736365) has the molecular formula C20H23ClFNO3 and a molecular weight of 379.86 g/mol. Its IUPAC name is [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate.
| Compound Name | [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7736365 |
| Molecular Formula | C20H23ClFNO3 |
| Molecular Weight | 379.86 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1c(F)cccc1Cl)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C20H23ClFNO3/c1-14(20(25)23-13-12-15-6-3-2-4-7-15)26-19(24)11-10-16-17(21)8-5-9-18(16)22/h5-6,8-11,14H,2-4,7,12-13H2,1H3,(H,23,25)/b11-10+/t14-/m1/s1 |
| InChIKey | SDVCDDQAEOXVGD-PLSXKVAHSA-N |
| XLogP | 4.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.86 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|