C13H7ClF2N2O3 — CID 773721
2-chloro-N-(2,4-difluorophenyl)-4-nitrobenzamide (PubChem CID 773721) has the molecular formula C13H7ClF2N2O3 and a molecular weight of 312.66 g/mol. Its IUPAC name is 2-chloro-N-(2,4-difluorophenyl)-4-nitrobenzamide.
| Compound Name | 2-chloro-N-(2,4-difluorophenyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 773721 |
| Molecular Formula | C13H7ClF2N2O3 |
| Molecular Weight | 312.66 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 2-chloro-N-(2,4-difluorophenyl)-4-nitrobenzamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C13H7ClF2N2O3/c14-10-6-8(18(20)21)2-3-9(10)13(19)17-12-4-1-7(15)5-11(12)16/h1-6H,(H,17,19) |
| InChIKey | ARTCUTQGUVJVLD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|