About 3-methylbenzo[g][1,2]benzothiazole
3-methylbenzo[g][1,2]benzothiazole (PubChem CID 773815) has the molecular formula C12H9NS
and a molecular weight of 199.28 g/mol. Its IUPAC name is 3-methylbenzo[g][1,2]benzothiazole.
Molecular Properties
| Compound Name | 3-methylbenzo[g][1,2]benzothiazole |
| PubChem CID | 773815 |
| Molecular Formula | C12H9NS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 3-methylbenzo[g][1,2]benzothiazole |
| SMILES | Cc1nsc2c1ccc1ccccc12 |
| InChI | InChI=1S/C12H9NS/c1-8-10-7-6-9-4-2-3-5-11(9)12(10)14-13-8/h2-7H,1H3 |
| InChIKey | QRAOIGYCGXKKQG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylbenzo[g][1,2]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbenzo[g][1,2]benzothiazole?
The IUPAC name of 3-methylbenzo[g][1,2]benzothiazole (CID 773815) is 3-methylbenzo[g][1,2]benzothiazole.
What is the SMILES notation for 3-methylbenzo[g][1,2]benzothiazole?
The canonical SMILES for 3-methylbenzo[g][1,2]benzothiazole is Cc1nsc2c1ccc1ccccc12.
What is the InChIKey of 3-methylbenzo[g][1,2]benzothiazole?
The InChIKey is QRAOIGYCGXKKQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NS/c1-8-10-7-6-9-4-2-3-5-11(9)12(10)14-13-8/h2-7H,1H3.
What are the key properties of 3-methylbenzo[g][1,2]benzothiazole?
3-methylbenzo[g][1,2]benzothiazole has a molecular weight of 199.28 g/mol, XLogP of 3.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbenzo[g][1,2]benzothiazole is sourced from PubChem (CID 773815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).