3-amino-4-anilinobenzoic acid

C13H12N2O2 — CID 773821

IUPAC3-amino-4-anilinobenzoic acid
SMILESNc1cc(C(=O)O)ccc1Nc1ccccc1
InChIInChI=1S/C13H12N2O2/c14-11-8-9(13(16)17)6-7-12(11)15-10-4-2-1-3-5-10/h1-8,15H,14H2,(H,16,17)
InChIKeySOSRJZNYVRVFOH-UHFFFAOYSA-N
MW228.25 g/mol
LogP2.71
Rot. Bonds3

About 3-amino-4-anilinobenzoic acid

3-amino-4-anilinobenzoic acid (PubChem CID 773821) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 3-amino-4-anilinobenzoic acid.

Molecular Properties

Compound Name3-amino-4-anilinobenzoic acid
PubChem CID773821
Molecular FormulaC13H12N2O2
Molecular Weight228.25 g/mol
Exact Mass228.09
IUPAC Name3-amino-4-anilinobenzoic acid
SMILESNc1cc(C(=O)O)ccc1Nc1ccccc1
InChIInChI=1S/C13H12N2O2/c14-11-8-9(13(16)17)6-7-12(11)15-10-4-2-1-3-5-10/h1-8,15H,14H2,(H,16,17)
InChIKeySOSRJZNYVRVFOH-UHFFFAOYSA-N
XLogP2.71
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.25
LogP ≤ 52.71
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 3-amino-4-anilinobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-4-anilinobenzoic acid?
The IUPAC name of 3-amino-4-anilinobenzoic acid (CID 773821) is 3-amino-4-anilinobenzoic acid.
What is the SMILES notation for 3-amino-4-anilinobenzoic acid?
The canonical SMILES for 3-amino-4-anilinobenzoic acid is Nc1cc(C(=O)O)ccc1Nc1ccccc1.
What is the InChIKey of 3-amino-4-anilinobenzoic acid?
The InChIKey is SOSRJZNYVRVFOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2/c14-11-8-9(13(16)17)6-7-12(11)15-10-4-2-1-3-5-10/h1-8,15H,14H2,(H,16,17).
What are the key properties of 3-amino-4-anilinobenzoic acid?
3-amino-4-anilinobenzoic acid has a molecular weight of 228.25 g/mol, XLogP of 2.71, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-anilinobenzoic acid is sourced from PubChem (CID 773821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).