C16H10Cl2F3N3O2 — CID 7738333
N'-[(Z)-(2,6-dichlorophenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide (PubChem CID 7738333) has the molecular formula C16H10Cl2F3N3O2 and a molecular weight of 404.18 g/mol. Its IUPAC name is N'-[(Z)-(2,6-dichlorophenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-[(Z)-(2,6-dichlorophenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 7738333 |
| Molecular Formula | C16H10Cl2F3N3O2 |
| Molecular Weight | 404.18 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | N'-[(Z)-(2,6-dichlorophenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]oxamide |
| SMILES | O=C(N/N=C\c1c(Cl)cccc1Cl)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H10Cl2F3N3O2/c17-12-5-2-6-13(18)11(12)8-22-24-15(26)14(25)23-10-4-1-3-9(7-10)16(19,20)21/h1-8H,(H,23,25)(H,24,26)/b22-8- |
| InChIKey | IQXDCQIKLPTDDD-UYOCIXKTSA-N |
| XLogP | 4.10 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.18 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|