C18H21N3O6 — CID 7738355
ethyl 2-[[2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]benzoate (PubChem CID 7738355) has the molecular formula C18H21N3O6 and a molecular weight of 375.38 g/mol. Its IUPAC name is ethyl 2-[[2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 7738355 |
| Molecular Formula | C18H21N3O6 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | ethyl 2-[[2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]benzoate |
| SMILES | CCCCN1C(=O)C(=O)N(CC(=O)Nc2ccccc2C(=O)OCC)C1=O |
| InChI | InChI=1S/C18H21N3O6/c1-3-5-10-20-15(23)16(24)21(18(20)26)11-14(22)19-13-9-7-6-8-12(13)17(25)27-4-2/h6-9H,3-5,10-11H2,1-2H3,(H,19,22) |
| InChIKey | LKDDMJVWZFUSNP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|