C21H37N3O2Si — CID 77386307
5-(2-aminopropyl)-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,3-dihydroindole-7-carboxamide (PubChem CID 77386307) has the molecular formula C21H37N3O2Si and a molecular weight of 391.63 g/mol. Its IUPAC name is 5-(2-aminopropyl)-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,3-dihydroindole-7-carboxamide.
| Compound Name | 5-(2-aminopropyl)-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,3-dihydroindole-7-carboxamide |
|---|---|
| PubChem CID | 77386307 |
| Molecular Formula | C21H37N3O2Si |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 5-(2-aminopropyl)-1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,3-dihydroindole-7-carboxamide |
| SMILES | CC(N)Cc1cc2c(c(C(N)=O)c1)N(CCCO[Si](C)(C)C(C)(C)C)CC2 |
| InChI | InChI=1S/C21H37N3O2Si/c1-15(22)12-16-13-17-8-10-24(19(17)18(14-16)20(23)25)9-7-11-26-27(5,6)21(2,3)4/h13-15H,7-12,22H2,1-6H3,(H2,23,25) |
| InChIKey | XUNQHDOEHFDLNY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|