About 7-ethylidenefuro[3,4-e][1,2,4]triazin-5-one
7-ethylidenefuro[3,4-e][1,2,4]triazin-5-one (PubChem CID 77389948) has the molecular formula C7H5N3O2
and a molecular weight of 163.14 g/mol. Its IUPAC name is 7-ethylidenefuro[3,4-e][1,2,4]triazin-5-one.
Molecular Properties
| Compound Name | 7-ethylidenefuro[3,4-e][1,2,4]triazin-5-one |
| PubChem CID | 77389948 |
| Molecular Formula | C7H5N3O2 |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 7-ethylidenefuro[3,4-e][1,2,4]triazin-5-one |
| SMILES | CC=C1OC(=O)c2ncnnc21 |
| InChI | InChI=1S/C7H5N3O2/c1-2-4-5-6(7(11)12-4)8-3-9-10-5/h2-3H,1H3 |
| InChIKey | WJIXPNDLTYWJBM-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-ethylidenefuro[3,4-e][1,2,4]triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethylidenefuro[3,4-e][1,2,4]triazin-5-one?
The IUPAC name of 7-ethylidenefuro[3,4-e][1,2,4]triazin-5-one (CID 77389948) is 7-ethylidenefuro[3,4-e][1,2,4]triazin-5-one.
What is the SMILES notation for 7-ethylidenefuro[3,4-e][1,2,4]triazin-5-one?
The canonical SMILES for 7-ethylidenefuro[3,4-e][1,2,4]triazin-5-one is CC=C1OC(=O)c2ncnnc21.
What is the InChIKey of 7-ethylidenefuro[3,4-e][1,2,4]triazin-5-one?
The InChIKey is WJIXPNDLTYWJBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2/c1-2-4-5-6(7(11)12-4)8-3-9-10-5/h2-3H,1H3.
What are the key properties of 7-ethylidenefuro[3,4-e][1,2,4]triazin-5-one?
7-ethylidenefuro[3,4-e][1,2,4]triazin-5-one has a molecular weight of 163.14 g/mol, XLogP of 0.40, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethylidenefuro[3,4-e][1,2,4]triazin-5-one is sourced from PubChem (CID 77389948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).