C20H25N3O4S — CID 7739312
[2-(3-cyanoanilino)-2-oxoethyl] 2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanylacetate (PubChem CID 7739312) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is [2-(3-cyanoanilino)-2-oxoethyl] 2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanylacetate.
| Compound Name | [2-(3-cyanoanilino)-2-oxoethyl] 2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 7739312 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | [2-(3-cyanoanilino)-2-oxoethyl] 2-[2-[cyclohexyl(methyl)amino]-2-oxoethyl]sulfanylacetate |
| SMILES | CN(C(=O)CSCC(=O)OCC(=O)Nc1cccc(C#N)c1)C1CCCCC1 |
| InChI | InChI=1S/C20H25N3O4S/c1-23(17-8-3-2-4-9-17)19(25)13-28-14-20(26)27-12-18(24)22-16-7-5-6-15(10-16)11-21/h5-7,10,17H,2-4,8-9,12-14H2,1H3,(H,22,24) |
| InChIKey | ITSYYIUTVFJTGK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |