C16H14N8O2 — CID 77395469
5-nitro-6-[[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]amino]pyridine-3-carbonitrile (PubChem CID 77395469) has the molecular formula C16H14N8O2 and a molecular weight of 350.34 g/mol. Its IUPAC name is 5-nitro-6-[[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 5-nitro-6-[[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 77395469 |
| Molecular Formula | C16H14N8O2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 5-nitro-6-[[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(NC2CCN(c3ncnc4[nH]ccc34)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H14N8O2/c17-6-10-5-13(24(25)26)15(19-7-10)22-11-2-4-23(8-11)16-12-1-3-18-14(12)20-9-21-16/h1,3,5,7,9,11H,2,4,8H2,(H,19,22)(H,18,20,21) |
| InChIKey | BYDJCKAAVBGCFM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 136.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|