C24H38N2O3 — CID 77395733
N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]icosa-5,8,11,14-tetraenamide (PubChem CID 77395733) has the molecular formula C24H38N2O3 and a molecular weight of 402.58 g/mol. Its IUPAC name is N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]icosa-5,8,11,14-tetraenamide.
| Compound Name | N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]icosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 77395733 |
| Molecular Formula | C24H38N2O3 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | N-[(3-oxo-1,2-oxazolidin-5-yl)methyl]icosa-5,8,11,14-tetraenamide |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)NCC1CC(=O)NO1 |
| InChI | InChI=1S/C24H38N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(27)25-21-22-20-24(28)26-29-22/h6-7,9-10,12-13,15-16,22H,2-5,8,11,14,17-21H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | IZNFROYFHHSMGE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|