C30H23F4N3O3 — CID 77396848
5-[6-[[1-(4-cyanophenyl)-2,2,2-trifluoroethyl]carbamoyl]-2-(4-fluorophenyl)quinolin-3-yl]pentanoic acid (PubChem CID 77396848) has the molecular formula C30H23F4N3O3 and a molecular weight of 549.52 g/mol. Its IUPAC name is 5-[6-[[1-(4-cyanophenyl)-2,2,2-trifluoroethyl]carbamoyl]-2-(4-fluorophenyl)quinolin-3-yl]pentanoic acid.
| Compound Name | 5-[6-[[1-(4-cyanophenyl)-2,2,2-trifluoroethyl]carbamoyl]-2-(4-fluorophenyl)quinolin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 77396848 |
| Molecular Formula | C30H23F4N3O3 |
| Molecular Weight | 549.52 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | 5-[6-[[1-(4-cyanophenyl)-2,2,2-trifluoroethyl]carbamoyl]-2-(4-fluorophenyl)quinolin-3-yl]pentanoic acid |
| SMILES | N#Cc1ccc(C(NC(=O)c2ccc3nc(-c4ccc(F)cc4)c(CCCCC(=O)O)cc3c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H23F4N3O3/c31-24-12-9-19(10-13-24)27-21(3-1-2-4-26(38)39)15-23-16-22(11-14-25(23)36-27)29(40)37-28(30(32,33)34)20-7-5-18(17-35)6-8-20/h5-16,28H,1-4H2,(H,37,40)(H,38,39) |
| InChIKey | YHDCGSSLGNTZKF-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.52 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|